|
|
| | 3-Methyl-1,2,4-thiadiazole-5-carbohydrazide Basic information |
| Product Name: | 3-Methyl-1,2,4-thiadiazole-5-carbohydrazide | | Synonyms: | 3-Methyl-1,2,4-thiadiazole-5-carbohydrazide;3-Methyl-1,2,4-thiadiazole-2(3h)-carbohydrazide;1,2,4-Thiadiazole-5-carboxylic acid, 3-methyl-, hydrazide;3-Methyl-1,2,4-thiadiazole-5-carbohydrazideQ: What is
3-Methyl-1,2,4-thiadiazole-5-carbohydrazide Q: What is the CAS Number of
3-Methyl-1,2,4-thiadiazole-5-carbohydrazide;3-methyl-1,2,4-thiadiazole-5-carbohydrazid;3-Methyl-1,2,4-thiadiazole-5-carboxylic acid hydrazide;Fezolinetant Impurity 4 | | CAS: | 1375066-73-1 | | MF: | C4H6N4OS | | MW: | 158.18 | | EINECS: | | | Product Categories: | | | Mol File: | 1375066-73-1.mol |  |
| | 3-Methyl-1,2,4-thiadiazole-5-carbohydrazide Chemical Properties |
| density | 1.449±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 9.86±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C4H6N4OS/c1-2-6-4(10-8-2)3(9)7-5/h5H2,1H3,(H,7,9) | | InChIKey | UJQISHJANPSPTN-UHFFFAOYSA-N | | SMILES | S1C(C(NN)=O)=NC(C)=N1 |
| | 3-Methyl-1,2,4-thiadiazole-5-carbohydrazide Usage And Synthesis |
| | 3-Methyl-1,2,4-thiadiazole-5-carbohydrazide Preparation Products And Raw materials |
|