| Company Name: |
Shanghai Anmike Chemical Co. Ltd. Gold
|
| Tel: |
微信 17321281695 18019252918 |
| Email: |
sale@amkchem.com |
| Products Intro: |
Product Name:Methyl 2-(2-chloropyridin-3-yl)acetate
CAS:123222-09-3
Purity:97% Package:1g,100g,1kg
|
|
| | (2-Chloro-pyridin-3-yl)-acetic acid methyl ester Basic information |
| | (2-Chloro-pyridin-3-yl)-acetic acid methyl ester Chemical Properties |
| Boiling point | 270.1±25.0 °C(Predicted) | | density | 1.259±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 0.10±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H8ClNO2/c1-12-7(11)5-6-3-2-4-10-8(6)9/h2-4H,5H2,1H3 | | InChIKey | HGRQGJYEMNWDFM-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC=C1CC(OC)=O |
| | (2-Chloro-pyridin-3-yl)-acetic acid methyl ester Usage And Synthesis |
| | (2-Chloro-pyridin-3-yl)-acetic acid methyl ester Preparation Products And Raw materials |
|