| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | 5-Trifluoromethyl-1H-Pyrrole-2-Carboxylic Acid Basic information |
| | 5-Trifluoromethyl-1H-Pyrrole-2-Carboxylic Acid Chemical Properties |
| Boiling point | 305.1±42.0 °C(Predicted) | | density | 1.573±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 3.63±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H4F3NO2/c7-6(8,9)4-2-1-3(10-4)5(11)12/h1-2,10H,(H,11,12) | | InChIKey | WYSJKCJUZUYPGO-UHFFFAOYSA-N | | SMILES | N1C(C(F)(F)F)=CC=C1C(O)=O |
| | 5-Trifluoromethyl-1H-Pyrrole-2-Carboxylic Acid Usage And Synthesis |
| | 5-Trifluoromethyl-1H-Pyrrole-2-Carboxylic Acid Preparation Products And Raw materials |
|