| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | tert-Butyl 1-(2-methoxyacetyl)piperidin-4-ylcarbamate Basic information |
| | tert-Butyl 1-(2-methoxyacetyl)piperidin-4-ylcarbamate Chemical Properties |
| Boiling point | 415.2±45.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | pka | 12.17±0.20(Predicted) | | form | solid | | InChI | 1S/C13H24N2O4/c1-13(2,3)19-12(17)14-10-5-7-15(8-6-10)11(16)9-18-4/h10H,5-9H2,1-4H3,(H,14,17) | | InChIKey | XCVJQWFWSCEPPL-UHFFFAOYSA-N | | SMILES | O=C(OC(C)(C)C)NC1CCN(C(COC)=O)CC1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | tert-Butyl 1-(2-methoxyacetyl)piperidin-4-ylcarbamate Usage And Synthesis |
| | tert-Butyl 1-(2-methoxyacetyl)piperidin-4-ylcarbamate Preparation Products And Raw materials |
|