| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 1,2-Dioleoyl-sn-glycero-3-phosphoethanolamine-N-[3-(2-pyridyldithio)propionate] Basic information |
| | 1,2-Dioleoyl-sn-glycero-3-phosphoethanolamine-N-[3-(2-pyridyldithio)propionate] Chemical Properties |
| storage temp. | -20°C | | form | liquid | | InChIKey | LFMWVVNPVNIPJG-JQRYTBKHSA-M | | SMILES | [H][C@@](COP([O-])(OCCNC(CCSSC1=CC=CC=N1)=O)=O)(OC(CCCCCCC/C=C\CCCCCCCC)=O)COC(CCCCCCC/C=C\CCCCCCCC)=O.[Na+] |
| WGK Germany | WGK 3 | | Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Carc. 2 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT RE 1 STOT SE 3 |
| | 1,2-Dioleoyl-sn-glycero-3-phosphoethanolamine-N-[3-(2-pyridyldithio)propionate] Usage And Synthesis |
| Uses | 18:1 PDP PE may be used in the preparation of hydrophobized disulfide-linked oligodeoxyribonucleotide (ODN). It may also be used in the preparation of liposomes. |
| | 1,2-Dioleoyl-sn-glycero-3-phosphoethanolamine-N-[3-(2-pyridyldithio)propionate] Preparation Products And Raw materials |
|