| Company Name: |
Wuhan TCASChem Technology Co., Ltd. Gold
|
| Tel: |
027-86697669 13986148687 |
| Email: |
sales@tcaschem.com |
| Products Intro: |
CAS:4244-59-1 Purity:96% Package:5g,10g,25g,100g,1kg
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-66061636 19370895928 |
| Email: |
qqyang@aikonchem.com |
| Products Intro: |
Product Name:Propanoyl chloride, 3-methoxy- CAS:4244-59-1 Purity:95+% Package:1g;5g;10g
|
|
| | Propanoyl chloride, 3-methoxy- Basic information |
| | Propanoyl chloride, 3-methoxy- Chemical Properties |
| Boiling point | 64 °C(Press: 44 Torr) | | density | 1.1256 g/cm3 | | InChI | InChI=1S/C4H7ClO2/c1-7-3-2-4(5)6/h2-3H2,1H3 | | InChIKey | JSMDUOFOPDSKIQ-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)CCOC |
| | Propanoyl chloride, 3-methoxy- Usage And Synthesis |
| | Propanoyl chloride, 3-methoxy- Preparation Products And Raw materials |
|