|
|
| | 1-(4-Butyl-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid Basic information |
| Product Name: | 1-(4-Butyl-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid | | Synonyms: | OTAVA-BB BB7018611177;ZERENEX E/5111255;AURORA 17720;1-(4-Butylphenyl)-5-oxo-3-pyrrolidinecarboxylic acid;3-Pyrrolidinecarboxylic acid, 1-(4-butylphenyl)-5-oxo-;1-(4-Butyl-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid | | CAS: | 63674-57-7 | | MF: | C15H19NO3 | | MW: | 261.32 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 1-(4-Butyl-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid Chemical Properties |
| form | solid | | InChI | 1S/C15H19NO3/c1-2-3-4-11-5-7-13(8-6-11)16-10-12(15(18)19)9-14(16)17/h5-8,12H,2-4,9-10H2,1H3,(H,18,19) | | InChIKey | LMCVFDCBQBJVTN-UHFFFAOYSA-N | | SMILES | N2(CC(CC2=O)C(=O)O)c1ccc(cc1)CCCC |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | HazardClass | IRRITANT | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Skin Sens. 1 |
| | 1-(4-Butyl-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid Usage And Synthesis |
| | 1-(4-Butyl-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid Preparation Products And Raw materials |
|