- 2-Bromo-6-fluorotoluene
-
- $0.00 / 1g
-
2026-02-02
- CAS:1422-54-4
- Min. Order: 50mg
- Purity: 99%HPLC
- Supply Ability: 2000tons
|
| | 2-Bromo-6-fluorotoluene Basic information |
| | 2-Bromo-6-fluorotoluene Chemical Properties |
| Boiling point | 75-76°C 10mm | | density | 1.53 | | refractive index | 1.535 | | Fp | 76°C | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 2433658 | | InChI | InChI=1S/C7H6BrF/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 | | InChIKey | DJGXPFQIMLEVPA-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC(F)=C1C | | CAS DataBase Reference | 1422-54-4(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-Bromo-6-fluorotoluene Usage And Synthesis |
| Chemical Properties | Colorlessto light yellow liquid | | Uses | 2-Bromo-6-fluorotoluene is a toluene derivative, its structure contains bromine and fluorine atom active groups, so it has a high chemical reactivity and easily substitution and fluorination reaction with other compounds. It is mainly used as raw material or intermediate of organic synthesis. |
| | 2-Bromo-6-fluorotoluene Preparation Products And Raw materials |
|