|
|
| | CIS-5,8,11,14,17-EICOSAPENTAENOIC ACID METHYL ESTER Basic information |
| Product Name: | CIS-5,8,11,14,17-EICOSAPENTAENOIC ACID METHYL ESTER | | Synonyms: | METHYL EICOSAPENTAENOATE;METHYL CIS-5,8,11,14,17-EICOSAPENTAENOATE;METHYL ALL-CIS-5,8,11,14,17-EICOSAPENTAENOATE;ALL CIS-5,8,11,14,17-EICOSAPENTAENOIC ACID METHYL ESTER;ALL CIS 5-8-11-14-17 EPA METHYL ESTER;C20:5 (ALL CIS-5,8,11,14,17);EPA METHYL ESTER;CIS-5,8,11,14,17-EICOSAPENTAENOIC ACID METHYL ESTER | | CAS: | 2734-47-6 | | MF: | C21H32O2 | | MW: | 316.48 | | EINECS: | | | Product Categories: | Branched fatty acids (Methyl Branched)Other Lipid Related Products;FAMEs;Fatty Acids;Fatty AcidsFA/FAME/Lipids/Steroids;Lipid Analytical Standards;Neats&Single Component Solutions;Unsaturated fatty acids and derivatives | | Mol File: | 2734-47-6.mol |  |
| | CIS-5,8,11,14,17-EICOSAPENTAENOIC ACID METHYL ESTER Chemical Properties |
| Melting point | -91℃ | | Boiling point | 115-125℃ (0.005 Torr) | | density | 0.912±0.06 g/cm3(Predicted) | | refractive index | 1.4898 (589.3 nm 20℃) | | Fp | 104 °C | | storage temp. | -20°C | | solubility | chloroform: 50 mg/mL, clear, colorless | | form | liquid | | color | Colorless to light yellow | | BRN | 1914828 | | Major Application | food and beverages | | InChI | 1S/C21H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h4-5,7-8,10-11,13-14,16-17H,3,6,9,12,15,18-20H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16- | | InChIKey | QWDCYFDDFPWISL-JEBPEJKESA-N | | SMILES | CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)OC | | CAS Number Unlabeled | 2734-47-6 |
| | CIS-5,8,11,14,17-EICOSAPENTAENOIC ACID METHYL ESTER Usage And Synthesis |
| Uses | Methyl eicosapentaenoate is the methyl ester derivative of Eicosapentaenoic acid (E477800). Methyl eicosapentaenoate is a highly unsaturated compound that is extracted from algae, and has some practical application in protecting stored grains against rice weevils. | | Definition | ChEBI: Cis-5,8,11,14,17-eicosapentaenoic acid methyl ester is a fatty acid methyl ester. | | General Description | Methyl all-cis-5,8,11,14,17-eicosapentaenoate is a fatty acid methyl ester. |
| | CIS-5,8,11,14,17-EICOSAPENTAENOIC ACID METHYL ESTER Preparation Products And Raw materials |
| Raw materials | 3,6,9-Dodecatrienal, (3Z,6Z,9Z)--->5,8,11,14,17-Eicosapentaynoic acid-->1-Bromo-3-hexene-->5-Octenoic acid, 8-oxo-, methyl ester, (5Z)--->EPA | | Preparation Products | CIS-7,10,13,16,19-DOCOSAPENTAENOIC ACID METHYL ESTER |
|