Propanoic acid, 3,3'-[(1-methylethylidene)bis(thio)]bis- manufacturers
|
| | Propanoic acid, 3,3'-[(1-methylethylidene)bis(thio)]bis- Basic information |
| Product Name: | Propanoic acid, 3,3'-[(1-methylethylidene)bis(thio)]bis- | | Synonyms: | Propanoic acid, 3,3'-[(1-methylethylidene)bis(thio)]bis-;5,5-dimethyl-4,6-dithia-nonanedioic acid;(3,3'-(Propane-2,2-diylbis(sulfanediyl))dipropionic acid);3,3'-(propane-2,2-diylbis(sulfanediyl))dipropanoic acid;TK-COOH/3,3'-(Propane-2,2-diylbis(sulfanediyl))dipropionicacid;3,3′-[(1-Methylethylidene)bis(thio)]bis[propanoic acid];2,2-Bis(2-carboxyethylthio)propane;3,3'-(2,2-Propanediyldisulfanediyl)dipropanoic acid | | CAS: | 4265-59-2 | | MF: | C9H16O4S2 | | MW: | 252.35 | | EINECS: | | | Product Categories: | | | Mol File: | 4265-59-2.mol | ![Propanoic acid, 3,3'-[(1-methylethylidene)bis(thio)]bis- Structure](CAS/20180527/GIF/4265-59-2.gif) |
| | Propanoic acid, 3,3'-[(1-methylethylidene)bis(thio)]bis- Chemical Properties |
| Melting point | 76-78 °C | | Boiling point | 459.5±35.0 °C(Predicted) | | density | 1.298±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.02±0.10(Predicted) | | InChI | InChI=1S/C9H16O4S2/c1-9(2,14-5-3-7(10)11)15-6-4-8(12)13/h3-6H2,1-2H3,(H,10,11)(H,12,13) | | InChIKey | QMHSRLRLGYJODR-UHFFFAOYSA-N | | SMILES | C(SCCC(O)=O)(SCCC(O)=O)(C)C |
| | Propanoic acid, 3,3'-[(1-methylethylidene)bis(thio)]bis- Usage And Synthesis |
| | Propanoic acid, 3,3'-[(1-methylethylidene)bis(thio)]bis- Preparation Products And Raw materials |
|