| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 9(Z),12(E)-Octadecadienoic acid methyl ester Basic information |
| Product Name: | 9(Z),12(E)-Octadecadienoic acid methyl ester | | Synonyms: | 9,12-Octadecadienoic acid, methyl ester, (9Z,12E)-;Methyl 9(Z),12(E)-Octadecadienoate;9(Z),12(E)-OctadecadienoicacidMethylester in Methanol;Methyl 9c,12t-Octadecadienoate;Methyl cis , trans-9,12-octadecadienoate;9(Z),12(E)-Octadecadienoic acid methyl ester | | CAS: | 20221-26-5 | | MF: | C19H34O2 | | MW: | 294.47 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 9(Z),12(E)-Octadecadienoic acid methyl ester Chemical Properties |
| Boiling point | 373.3±21.0 °C(Predicted) | | density | 0.884±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C19H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h7-8,10-11H,3-6,9,12-18H2,1-2H3/b8-7+,11-10- | | InChIKey | WTTJVINHCBCLGX-LFOHPMNASA-N | | SMILES | C(OC)(=O)CCCCCCC/C=C\C/C=C/CCCCC |
| | 9(Z),12(E)-Octadecadienoic acid methyl ester Usage And Synthesis |
| Uses | Methyl (9Z,12E)-Octadeca-9,12-dienoate can be useful in thiyl radical-induced cis/trans-isomerization of methyl linoleate in methanol and of linoleic acid residues in liposomes. |
| | 9(Z),12(E)-Octadecadienoic acid methyl ester Preparation Products And Raw materials |
|