|
|
| | 4,4-Difluoropiperidine hydrochloride Basic information | | Uses |
| Product Name: | 4,4-Difluoropiperidine hydrochloride | | Synonyms: | 4,4-DIFLUOROPIPERIDINE HYDROCHLORIDE;4,4-DifluoropiperidineHCl;4,4-Difluoropiperidine hy...;4,4-Difluoropiperidine hydrochloride ,97%;Piperidine, 4,4-difluoro-, hydrochloride (1:1);4,4-Difluoropiperidine hydrochloride 97%;4,4-difluoropiperidin-1-ium;4,4-Difluoropiperidine hydrochloride ISO 9001:2015 REACH | | CAS: | 144230-52-4 | | MF: | C5H9F2N.ClH | | MW: | 157.59 | | EINECS: | 604-401-7 | | Product Categories: | Pyridine series;Building Blocks;Heterocyclic Building Blocks;Piperidines;11 | | Mol File: | 144230-52-4.mol |  |
| | 4,4-Difluoropiperidine hydrochloride Chemical Properties |
| Melting point | 173-177 °C | | storage temp. | 2-8°C | | form | crystalline solid | | color | White | | Sensitive | Hygroscopic | | BRN | 6812163 | | InChI | InChI=1S/C5H9F2N.ClH/c6-5(7)1-3-8-4-2-5;/h8H,1-4H2;1H | | InChIKey | OABUKBBBSMNNPM-UHFFFAOYSA-N | | SMILES | N1CCC(F)(F)CC1.[H]Cl | | CAS DataBase Reference | 144230-52-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4,4-Difluoropiperidine hydrochloride Usage And Synthesis |
| Uses | 4,4-Difluoropiperidine hydrochloride is a piperidine derivative, and as a pharmaceutical intermediate, it is in high demand. It is also an important fragment of novel histamine-3 receptor antagonists. | | Chemical Properties | White solid |
| | 4,4-Difluoropiperidine hydrochloride Preparation Products And Raw materials |
|