3'-O-(2-Methoxyethyl)guanosine manufacturers
|
| | 3'-O-(2-Methoxyethyl)guanosine Basic information |
| Product Name: | 3'-O-(2-Methoxyethyl)guanosine | | Synonyms: | 3'-O-(2-Methoxyethyl)guanosine;Guanosine, 3'-O-(2-methoxyethyl)- (9CI);3’-O-MOE-G;3'-MOE-Guanosine;3'-O-MOE-Guanosine;3’-O-(2-Methoxyethyl)guanosine;2-Amino-9-((2R,3R,4S,5R)-3-hydroxy-5-(hydroxymethyl)-4-(2-methoxyethoxy)tetrahydrofuran-2-yl)-3,9-dihydro-6H-purin-6-one | | CAS: | 256224-03-0 | | MF: | C13H19N5O6 | | MW: | 341.32 | | EINECS: | | | Product Categories: | | | Mol File: | 256224-03-0.mol |  |
| | 3'-O-(2-Methoxyethyl)guanosine Chemical Properties |
| form | Solid | | color | White to off-white | | InChI | InChI=1S/C13H19N5O6/c1-22-2-3-23-9-6(4-19)24-12(8(9)20)18-5-15-7-10(18)16-13(14)17-11(7)21/h5-6,8-9,12,19-20H,2-4H2,1H3,(H3,14,16,17,21)/t6-,8-,9-,12-/m1/s1 | | InChIKey | BPFOZTYDUWLNNN-WOUKDFQISA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)N)=O)N=C2)[C@H](O)[C@@H]1OCCOC |
| | 3'-O-(2-Methoxyethyl)guanosine Usage And Synthesis |
| Description | 3'-O-(2-Methoxyethyl)guanosine is a guanosine analogue. Some guanosine analogs have immunostimulatory activity. In some animal models, they also induce type I interferons, producing antiviral effects. Studies have shown that the functional activity of guanosine analogs is dependent on the activation of Toll-like receptor 7 (TLR7). | | Uses |
3'-O-(2-Methoxyethyl)guanosine is a remarkable modified nucleoside with immense potential in the field of antiviral drug discovery. This exquisite compound takes center stage in targeting viral RNA-dependent RNA polymerases, thus rendering it a powerful weapon in research of respiratory syncytial virus (RSV) and hepatitis C virus (HCV).
|
| | 3'-O-(2-Methoxyethyl)guanosine Preparation Products And Raw materials |
|