[4-(cyclohexyloxy)phenyl]boronic acid manufacturers
|
| | [4-(cyclohexyloxy)phenyl]boronic acid Basic information |
| Product Name: | [4-(cyclohexyloxy)phenyl]boronic acid | | Synonyms: | [4-(cyclohexyloxy)phenyl]boronic acid;Boronic acid, [4-(cyclohexyloxy)phenyl]-;Boronic acid, B-[4-(cyclohexyloxy)phenyl]-;4-cyclohexyloxybenzeneboronic acid;(4-(Cyclohexyloxy)phenyl)boronic acid - [C89634] | | CAS: | 570398-88-8 | | MF: | C12H17BO3 | | MW: | 220.07 | | EINECS: | | | Product Categories: | | | Mol File: | 570398-88-8.mol | ![[4-(cyclohexyloxy)phenyl]boronic acid Structure](CAS/20180527/GIF/570398-88-8.gif) |
| | [4-(cyclohexyloxy)phenyl]boronic acid Chemical Properties |
| Boiling point | 390.7±44.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 8.71±0.16(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C12H17BO3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h6-9,11,14-15H,1-5H2 | | InChIKey | LRWBGLILWSKAMP-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(OC2CCCCC2)C=C1)(O)O |
| | [4-(cyclohexyloxy)phenyl]boronic acid Usage And Synthesis |
| | [4-(cyclohexyloxy)phenyl]boronic acid Preparation Products And Raw materials |
|