Maleimide-DOTA manufacturers
- Maleimide-DOTA
-
-
2026-07-31
- CAS:1006711-90-5
- Purity: 99.88%
- Supply Ability: 10g
- DOTA-Maleimide
-
-
2025-06-07
- CAS:1006711-90-5
- Min. Order: 1g
- Purity: >95.00%
- Supply Ability: 1g
|
| | Maleimide-DOTA Basic information |
| Product Name: | Maleimide-DOTA | | Synonyms: | 1,4,7,10-Tetraazacyclododecane-1,4,7-triacetic acid, 10-[2-[[2-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethyl]amino]-2-oxoethyl]-;Maleimido-mono-amide-DOTA,DOTA-Maleimide;DOTA-Maleimide,Maleimido-mono-amide-DOTA;Maleimide-DOTA;DOTA-C2-Mal;2,2',2''-(10-(2-((2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethyl)amino)-2-oxoethyl)-1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetic acid;DOTA-Maleimide | | CAS: | 1006711-90-5 | | MF: | C22H34N6O9 | | MW: | 526.54016 | | EINECS: | | | Product Categories: | | | Mol File: | 1006711-90-5.mol |  |
| | Maleimide-DOTA Chemical Properties |
| storage temp. | -20°C, sealed storage, away from moisture and light | | form | Solid | | color | White to yellow | | InChIKey | AUTDIWAXETZSGJ-UHFFFAOYSA-N | | SMILES | N1(CC(O)=O)CCN(CC(NCCN2C(=O)C=CC2=O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CC1 |
| | Maleimide-DOTA Usage And Synthesis |
| Uses | Maleimide-DOTA is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). | | Biological Activity | Maleimide-DOTA is a non-degradable ADC linker for antibody drug conjugate (ADC) synthesis. | | target | | | IC 50 | Non-cleavable Linker |
| | Maleimide-DOTA Preparation Products And Raw materials |
|