|
|
| | 9-METHOXY-9-BORABICYCLO[3.3.1]NONANE Basic information |
| Product Name: | 9-METHOXY-9-BORABICYCLO[3.3.1]NONANE | | Synonyms: | 9-Borabicyclo[3.3.1]nonane,9-methoxy-;9-METHOXY-9-BORABICYCLO[3.3.1]NONANE;9-Methoxy-9-borabicycL;B-METHOXY-9-BBN;B-METHOXY-9-BBN, 1.0M SOLUTION IN HEXANE S;b-methoxy-9-bbn solution;8-Methoxy-9-borabicyclo[3,3,1]nonane;9- methoxy-9-borabicyclo[3.3.1]nonane 1.0M in hexanes | | CAS: | 38050-71-4 | | MF: | C9H17BO | | MW: | 152.04 | | EINECS: | 253-758-1 | | Product Categories: | | | Mol File: | 38050-71-4.mol | ![9-METHOXY-9-BORABICYCLO[3.3.1]NONANE Structure](CAS/GIF/38050-71-4.gif) |
| | 9-METHOXY-9-BORABICYCLO[3.3.1]NONANE Chemical Properties |
| Boiling point | 57-58 °C(Press: 7 Torr) | | density | 0.716 g/mL at 25 °C | | Fp | −9 °F | | form | liquid | | InChI | InChI=1S/C9H17BO/c1-11-10-8-4-2-5-9(10)7-3-6-8/h8-9H,2-7H2,1H3 | | InChIKey | UNGDGQYONLTNJZ-UHFFFAOYSA-N | | SMILES | C12B(OC)C(CCC1)CCC2 |
| | 9-METHOXY-9-BORABICYCLO[3.3.1]NONANE Usage And Synthesis |
| Uses | Pro-nucleophile and co-catalyst for indium-catalyzed allylations of methyl ethers and carbohydrate derivatives. Catalyst for preparation of linear allenes from other allenes 2 Reactant for: Stereoconvergent Suzuki cross-coupling reactions 3 B-alkyl Suzuki-Miyaura cross-coupling reactions 4 Preparation of borabicyclononanyl amino acid complexes for selective treatment of malignant melanoma 5 Asymmetric synthesis of isomerically pure allenyl boranes through insertion and borotropic rearrangement. | | Uses | 9-Methoxy-9-borabicyclo[3.3.1]nonane is a coupling reagent used in reactions like the synthesis of (-)-brevenal a polycyclic ether. | | Uses | - Pro-nucleophile and co-catalyst for indium-catalyzed allylations of methyl ethers and carbohydrate derivatives
- Catalyst for preparation of linear allenes from other allenes
Reactant for:
- Stereoconvergent Suzuki cross-coupling reactions
- B-alkyl Suzuki-Miyaura cross-coupling reactions
- Preparation of borabicyclononanyl amino acid complexes for selective treatment of malignant melanoma
- Asymmetric synthesis of isomerically pure allenyl boranes through insertion and borotropic rearrangement
| | reaction suitability | reaction type: C-C Bond Formation |
| | 9-METHOXY-9-BORABICYCLO[3.3.1]NONANE Preparation Products And Raw materials |
|