| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | oxalic acid Basic information |
| Product Name: | oxalic acid | | Synonyms: | 1-(3-Chloropropyl)pyrrolidine oxalate(1:?);1-(3-Chloropropyl)pyrrolidine Oxalate;1-(3-Chloropropyl)pyrrolidine oxalate(1:x);N-(3-Chloropropyl)pyrrolidine oxalate | | CAS: | 1022112-22-6 | | MF: | C9H16ClNO4 | | MW: | 237.68 | | EINECS: | | | Product Categories: | | | Mol File: | 1022112-22-6.mol |  |
| | oxalic acid Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | InChI | InChI=1S/C7H14ClN.C2H2O4/c8-4-3-7-9-5-1-2-6-9;3-1(4)2(5)6/h1-7H2;(H,3,4)(H,5,6) | | InChIKey | CYNQUJRBWOSZQQ-UHFFFAOYSA-N | | SMILES | C(=O)(O)C(=O)O.C(N1CCCC1)CCCl | | CAS DataBase Reference | 1022112-22-6 |
| | oxalic acid Usage And Synthesis |
| | oxalic acid Preparation Products And Raw materials |
|