- 3,4-diacetoxystyrene
-
- $0.00 / 25kg
-
2025-12-01
- CAS:57142-64-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- 3,4-diacetoxystyrene
-
- $0.00 / 1KG
-
2025-11-21
- CAS:57142-64-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 tons
- 3,4-diacetoxystyrene
-
- $3.90 / 100KG
-
2025-10-13
- CAS:57142-64-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3,4-diacetoxystyrene Basic information |
| Product Name: | 3,4-diacetoxystyrene | | Synonyms: | 3,4-diacetoxystyrene;1,2-Benzenediol, 4-ethenyl-, 1,2-diacetate;Acetic acid,4-ethenylbenzene-1,2-diol;4-Vinyl-1,2-phenylene diacetate;1,2-Benzenediol, 4-ethenyl-, diacetate;MPACS | | CAS: | 57142-64-0 | | MF: | C12H12O4 | | MW: | 220.22 | | EINECS: | | | Product Categories: | | | Mol File: | 57142-64-0.mol |  |
| | 3,4-diacetoxystyrene Chemical Properties |
| InChI | InChI=1S/C12H12O4/c1-4-10-5-6-11(15-8(2)13)12(7-10)16-9(3)14/h4-7H,1H2,2-3H3 | | InChIKey | BGDWDFVUSUCDHI-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C)=CC=C(C=C)C=C1OC(=O)C |
| | 3,4-diacetoxystyrene Usage And Synthesis |
| Uses | 3,4-diacetoxystyrene can serve as a fluorescent or linking group and participate in the synthesis of various anti-tumor drugs. For example, it can promote tumour cell death by binding to DNA or serve as a fluorescent probe for tumour cell imaging. 3,4-diacetoxystyrene plays an essential role in the synthesis of anti-inflammatory drugs. It can serve as a structural template for osteoporosis drugs, enhancing their anti-inflammatory activity by modifying their substituents or introducing double bonds. | | Synthesis Reference(s) | [1] The preparation method of one kind 3,4- diacetoxy styrene. CN108129318A | | Materials Uses | 3,4-diacetoxystyrene is a kind of aromatic compound with potential practicability, and is an important polymer monomer, which can be used for the preparation of resins, coatings, electronic materials, etc. | | Synthesis | the preparation method of 3,4-diacetoxystyrene comprising: at a temperature of 60-70°C, 3,4-dihydroxybenzaldehyde and malonic acid in at least one organic solvent React under the condition that and catalyst exists, generate the first reaction mixture that comprises 3,4-dihydroxycinnamic acid; Be heated up to 80-90 ℃, make the first reaction mixture continue to react, generate the first reaction mixture that comprises 3,4-dihydroxystyrene The second reaction mixture; the second reaction mixture is purified to obtain 3,4-diacetoxystyrene; at a temperature of 10-20°C, 3,4-dihydroxystyrene reacts with an acetylating reagent to generate 3,4-dihydroxystyrene A third reaction mixture of diacetoxystyrene; purification of the third reaction mixture yields 3,4-diacetoxystyrene.[1] |
| | 3,4-diacetoxystyrene Preparation Products And Raw materials |
|