| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 1,4-bis(pyridin-4-ylethynyl)benzene Basic information |
| Product Name: | 1,4-bis(pyridin-4-ylethynyl)benzene | | Synonyms: | 1,4-bis(pyridin-4-ylethynyl)benzene;Pyridine, 4,4'-(1,4-phenylenedi-2,1-ethynediyl)bis-;DK7522;1,4-bis(4-pyridylethynyl)benzene;4-[2-[4-(2-pyridin-4-ylethynyl)phenyl]ethynyl]pyridine;1,4-Bis(pyridin-4-ylethynyl)benzene - [B94510] | | CAS: | 158525-01-0 | | MF: | C20H12N2 | | MW: | 280.32 | | EINECS: | | | Product Categories: | | | Mol File: | 158525-01-0.mol |  |
| | 1,4-bis(pyridin-4-ylethynyl)benzene Chemical Properties |
| Melting point | 185-203 °C | | Boiling point | 486.7±30.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.72±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C20H12N2/c1-2-18(6-8-20-11-15-22-16-12-20)4-3-17(1)5-7-19-9-13-21-14-10-19/h1-4,9-16H | | InChIKey | ONNGGLJSLBGWLB-UHFFFAOYSA-N | | SMILES | C1(C#CC2C=CN=CC=2)=CC=C(C#CC2C=CN=CC=2)C=C1 |
| | 1,4-bis(pyridin-4-ylethynyl)benzene Usage And Synthesis |
| | 1,4-bis(pyridin-4-ylethynyl)benzene Preparation Products And Raw materials |
|