| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 1,2,4,5-Tetrakis(3-carboxyphenyl)benzene Basic information |
| Product Name: | 1,2,4,5-Tetrakis(3-carboxyphenyl)benzene | | Synonyms: | 1,2,4,5-Tetrakis(3-carboxyphenyl)benzene;1,?1':2',?1''-?Terphenyl]?-?3,?3''-?dicarboxylic acid, 4',?5'-?bis(3-?carboxyphenyl)?-;1,2,4,5-tetra(3'-carboxyphenyl) benzene;4',5'-bis(3-carboxyphenyl)-[1,1':2',1''-terphenyl]-3,3''-dicarboxylic acid;CID 118103011 | | CAS: | 1629643-34-0 | | MF: | C34H22O8 | | MW: | 558.53 | | EINECS: | | | Product Categories: | | | Mol File: | 1629643-34-0.mol |  |
| | 1,2,4,5-Tetrakis(3-carboxyphenyl)benzene Chemical Properties |
| Boiling point | 843.6±65.0 °C(Predicted) | | density | 1.393±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.27±0.10(Predicted) | | Appearance | White to off-white Solid | | InChIKey | FEUJAYRFYGWSSY-UHFFFAOYSA-N | | SMILES | C1(C2=CC(C3=CC=CC(C(O)=O)=C3)=C(C3=CC=CC(C(O)=O)=C3)C=C2C2=CC=CC(C(O)=O)=C2)=CC=CC(C(O)=O)=C1 |
| | 1,2,4,5-Tetrakis(3-carboxyphenyl)benzene Usage And Synthesis |
| | 1,2,4,5-Tetrakis(3-carboxyphenyl)benzene Preparation Products And Raw materials |
|