|
|
| | 2-Chloro-4-(1-dibenzofuranyl)-6-phenyl-1,3,5-triazineine Basic information |
| Product Name: | 2-Chloro-4-(1-dibenzofuranyl)-6-phenyl-1,3,5-triazineine | | Synonyms: | 1,3,5-Triazine,2-chloro-4-(1-dibenzofuranyl)-6-phenyl-;2-Chloro-4-(dibenzofuran-1-yl)-6-phenyl-[1,3,5]triazine;2-Chloro-4-(1-dibenzofuranyl)-6-phenyl-1,3,5-triazine;2-Chloro-4-(1-dibenzofuranyl)-6-phenyl-1,3,5-triazineine;2-Chloro-4-(1-dibenzofuryl)-6-phenyl-1,3,5-triazine;2-chloro-4-(dibenzo[b,d]furan-1-yl)-6-phenyl-1,3,5-triazine | | CAS: | 1883265-32-4 | | MF: | C21H12ClN3O | | MW: | 357.79 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 1883265-32-4.mol |  |
| | 2-Chloro-4-(1-dibenzofuranyl)-6-phenyl-1,3,5-triazineine Chemical Properties |
| Boiling point | 613.2±47.0 °C(Predicted) | | density | 1.362±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -0.40±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C21H12ClN3O/c22-21-24-19(13-7-2-1-3-8-13)23-20(25-21)15-10-6-12-17-18(15)14-9-4-5-11-16(14)26-17/h1-12H | | InChIKey | PJJAZVKQILCJTF-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=CC=C2)N=C(C2=C3C4=CC=CC=C4OC3=CC=C2)N=C1Cl |
| | 2-Chloro-4-(1-dibenzofuranyl)-6-phenyl-1,3,5-triazineine Usage And Synthesis |
| Uses | Used as an intermediate in the organic synthesis. | | Synthesis | 2-Chloro-4-(1-dibenzofuranyl)-6-phenyl-1,3,5-triazineine is synthesized by reacting B-1-Dibenzofuranylboronic acid with 2,4-Dichloro-6-phenyl-1,3,5-triazine rufluxed in THF for overnight catalystsed by Tetrabutylammonium bromide.
 |
| | 2-Chloro-4-(1-dibenzofuranyl)-6-phenyl-1,3,5-triazineine Preparation Products And Raw materials |
|