2,5-Dimethylbenzenesulfonic acid dihydrate manufacturers
|
| | 2,5-Dimethylbenzenesulfonic acid dihydrate Basic information |
| | 2,5-Dimethylbenzenesulfonic acid dihydrate Chemical Properties |
| Melting point | 86°C | | Boiling point | 290.72°C (rough estimate) | | density | 1.3286 (rough estimate) | | refractive index | 1.5081 (estimate) | | storage temp. | 2-8°C | | Water Solubility | Soluble in water | | pka | -0.47±0.30(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light red | | Sensitive | Hygroscopic | | InChI | InChI=1S/C8H10O3S/c1-6-3-4-7(2)8(5-6)12(9,10)11/h3-5H,1-2H3,(H,9,10,11) | | InChIKey | IRLYGRLEBKCYPY-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC(C)=CC=C1C | | CAS DataBase Reference | 609-54-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 2,5-dimethyl- (609-54-1) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 2904.10.3700 |
| | 2,5-Dimethylbenzenesulfonic acid dihydrate Usage And Synthesis |
| Uses | Reagent for serum cholesterol determination. | | Production Methods | 2,5-Dimethylbenzenesulfonic acid dihydrate is obtained by sulfonating p-xylene with 93% sulfuric acid and removing the water by distillation. |
| | 2,5-Dimethylbenzenesulfonic acid dihydrate Preparation Products And Raw materials |
|