|
|
| | 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate Basic information |
| | 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate Chemical Properties |
| Melting point | 150-154℃ | | density | 1.541[at 20℃] | | vapor pressure | 0Pa at 20℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Methanol (Slightly), DMSO (Slightly) | | form | Solid | | color | Grey to Very Dark Grey | | Water Solubility | 81.9g/L at 20℃ | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | HAIR DYEING | | InChI | InChI=1S/C9H14N2O2.H2O4S/c1-13-9-3-2-7(6-8(9)10)11-4-5-12;1-5(2,3)4/h2-3,6,11-12H,4-5,10H2,1H3;(H2,1,2,3,4) | | InChIKey | GWHLYFOWAINYAH-UHFFFAOYSA-N | | SMILES | C1(NCCO)=CC=C(OC)C(N)=C1.S(=O)(=O)(O)O | | LogP | 0.59 at 20℃ | | CAS DataBase Reference | 83763-48-8(CAS DataBase Reference) |
| | 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate Usage And Synthesis |
| Chemical Properties | White to grey powder | | Uses | 5-(2-Hydroxyethylamino)-2-methoxylaniline Sulfate can be used to color and straighten keratin fibers. | | Flammability and Explosibility | Not classified |
| | 5-(2-Hydroxyethylamino)-2-methoxylaniline sulfate Preparation Products And Raw materials |
|