| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Poly[4,5-difluoro-2,2-bis(trifluoromethyl)-1,3-dioxole-co-tetrafluoroethylene] Basic information |
| Product Name: | Poly[4,5-difluoro-2,2-bis(trifluoromethyl)-1,3-dioxole-co-tetrafluoroethylene] | | Synonyms: | poly(4,5-difluoro-2,2-bis(cf3)-1,3-dioxole -co-tf;teflon af1600;teflon af2400;POLY(4,5-DIFLUORO-2,2-BIS(CF3)-1,3-DIOXO LE -CO-TFE), 87 MOLE % DIOXOLE;4,5-difluoro-2,2-bis(trifluoromethyl)-1,3-dioxole compound with perfluoroethene (1:1);POLY(4,5-DIFLUORO-2,2-BIS(CF3)-1,3-DIOXO LE -CO-TFE), 65 MOLE % DIOXOLE;ptfe af 1600;ptfe af 2400 | | CAS: | 37626-13-4 | | MF: | (C5F8O2.C2F4)x | | MW: | 344.05 | | EINECS: | | | Product Categories: | | | Mol File: | 37626-13-4.mol | ![Poly[4,5-difluoro-2,2-bis(trifluoromethyl)-1,3-dioxole-co-tetrafluoroethylene] Structure](CAS/20150408/GIF/37626-13-4.gif) |
| | Poly[4,5-difluoro-2,2-bis(trifluoromethyl)-1,3-dioxole-co-tetrafluoroethylene] Chemical Properties |
| density | 1.78 g/mL at 25 °C | | refractive index | n20/D 1.31 | | solubility | fluorinated solvents such as perfluoromethylcyclohexane, perfluorobenzene, and perfluorodecalin: soluble | | form | solid | | InChIKey | WAQVMMYKXQPUNG-UHFFFAOYSA-N | | SMILES | FC(F)(F)C1(OC(=C(O1)F)F)C(F)(F)F.FC(=C(F)F)F | | EPA Substance Registry System | 1,3-Dioxole, 4,5-difluoro-2,2-bis(trifluoromethyl)-, polymer with 1,1,2,2-tetrafluoroethene (37626-13-4) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Poly[4,5-difluoro-2,2-bis(trifluoromethyl)-1,3-dioxole-co-tetrafluoroethylene] Usage And Synthesis |
| Uses | Optoelectronic devices for optical clarity, low-refractive index coating for optical devices, protective coating for chemical resistance, release coating, and sight window for harsh chemical environments. | | General Description | Poly(4,5-difluoro-2,2-bis(trifluoromethyl)-1,3-dioxole-co-tetrafluoroethylene)(AF2400) is a fluorinated polymer that formed by copolymerization of 4,5-difluoro-2,2-(trifluoromethyl)-1,3-dioxole(PDD) and tetrafluoroethylene(TFE). It has a relatively high glass transition temperature(Tg) and optical transparency which allows it be a photo-stable polymer that can be used for a wide range of coating application in electronic and electrochemical industry. |
| | Poly[4,5-difluoro-2,2-bis(trifluoromethyl)-1,3-dioxole-co-tetrafluoroethylene] Preparation Products And Raw materials |
|