|
|
| | 4-Bromo-1,3-bis(trifluoromethyl)benzene Basic information |
| Product Name: | 4-Bromo-1,3-bis(trifluoromethyl)benzene | | Synonyms: | 2,4-bis-trifluoromethyl benzene bromide;2,4-DI(TRIFLUOROMETHYL)BROMOBENZENE;2,4-BIS(TRIFLUOROMETHYL)-1-BROMOBENZENE;1,3-BIS(TRIFLUOROMETHYL)-4-BROMOBENZENE;4-BROMO-1,3-BIS(TRIFLUOROMETHYL)BENZENE;2,4-BIS(TRIFLUOROMETHYL)BROMOBENZENE, 98 %;Benzene, 1-bromo-2,4-bis(trifluoromethyl)-;2,4-Bis(trifluoromethyl)bromobenzene 98% | | CAS: | 327-75-3 | | MF: | C8H3BrF6 | | MW: | 293 | | EINECS: | 642-640-9 | | Product Categories: | Fluorine series | | Mol File: | 327-75-3.mol |  |
| | 4-Bromo-1,3-bis(trifluoromethyl)benzene Chemical Properties |
| Boiling point | 158 °C740 mm Hg(lit.) | | density | 1.738 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.437(lit.) | | Fp | 157 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | Specific Gravity | 1.738 | | color | Colorless to Light yellow | | BRN | 6208648 | | InChI | 1S/C8H3BrF6/c9-6-2-1-4(7(10,11)12)3-5(6)8(13,14)15/h1-3H | | InChIKey | QDEJWLIKRLJYEK-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(Br)c(c1)C(F)(F)F | | CAS DataBase Reference | 327-75-3(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4-Bis(trifluoromethyl)bromobenzene(327-75-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-37 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 10 - Combustible liquids |
| | 4-Bromo-1,3-bis(trifluoromethyl)benzene Usage And Synthesis |
| Chemical Properties | clear colorless to slightly brown liquid | | Uses | 2,4-Bis(trifluoromethyl)bromobenzene may be used in chemical synthesis. |
| | 4-Bromo-1,3-bis(trifluoromethyl)benzene Preparation Products And Raw materials |
|