| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
Fluorochem Ltd |
| Tel: |
(01457) 868921 (4 lines) |
| Email: |
vernam@fluorochem.co.uk |
|
| | rac-(1S,5R)-9-methyl-3,9-diazabicyclo[3.3.2]decane dihydrochloride Basic information |
| | rac-(1S,5R)-9-methyl-3,9-diazabicyclo[3.3.2]decane dihydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C9H18N2.2ClH/c1-11-7-8-3-2-4-9(11)6-10-5-8;;/h8-10H,2-7H2,1H3;2*1H/t8-,9+;;/m1../s1 | | InChIKey | FPNFBQMYWMVKEG-BPRGXCPLSA-N | | SMILES | CN1C[C@@]2([H])CNC[C@]1([H])CCC2.Cl.Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | rac-(1S,5R)-9-methyl-3,9-diazabicyclo[3.3.2]decane dihydrochloride Usage And Synthesis |
| | rac-(1S,5R)-9-methyl-3,9-diazabicyclo[3.3.2]decane dihydrochloride Preparation Products And Raw materials |
|