- MBS Crosslinker
-
- $56.00 / 100mg
-
2026-03-13
- CAS:58626-38-3
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | 3-Maleimidobenzoic acid N-hydroxysuccinimide ester Basic information |
| | 3-Maleimidobenzoic acid N-hydroxysuccinimide ester Chemical Properties |
| Melting point | 175-177 °C(lit.) | | Boiling point | 524.5±52.0 °C(Predicted) | | density | 1.59±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | ethyl acetate or DMF: ≤20 mg/mL may require addition of solvent to coupling buffer to at least 5% to maintain solubility | | form | crystalline | | pka | -2.63±0.20(Predicted) | | color | White to Almost white | | Sensitive | Moisture & Light Sensitive | | BRN | 1505254 | | InChI | 1S/C15H10N2O6/c18-11-4-5-12(19)16(11)10-3-1-2-9(8-10)15(22)23-17-13(20)6-7-14(17)21/h1-5,8H,6-7H2 | | InChIKey | LLXVXPPXELIDGQ-UHFFFAOYSA-N | | SMILES | O=C1CCC(N1OC(C2=CC=CC(N3C(C=CC3=O)=O)=C2)=O)=O | | CAS DataBase Reference | 58626-38-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29280000 | | Storage Class | 11 - Combustible Solids |
| | 3-Maleimidobenzoic acid N-hydroxysuccinimide ester Usage And Synthesis |
| Description | MBS is a heterobifunction crosslinker that contains a maleimide group which is reactive towards sulfhydryls and an NHS ester, useful for targeting amine groups. | | Chemical Properties | Crystalline | | Uses | 3-Maleimidobenzoic acid N-hydroxysuccinimide ester is a heterobifunctional coupling reagent useful for forming enzyme immunoconjugates. The reactive groups are the NHS ester and maeimide. | | Uses | N-Succinimidyl 3-maleimidobenzoate is useful for forming enzyme immunoconjugates. It has a 9.9 Angstrom spacer arm. Heterobifunctional crosslinking reagent reactive toward primary amine and sulfhydryl. Useful for preparation of enzyme immunoconjugates and hapten carrier molecule conjugates | | reaction suitability | reagent type: cross-linking reagent | | Biochem/physiol Actions | 3-Maleimidobenzoic acid N-hydroxysuccinimide is used as a fixative for the preservation of pollen tube F-actin distribution. It imposes less damage when used on pollen tubes. |
| | 3-Maleimidobenzoic acid N-hydroxysuccinimide ester Preparation Products And Raw materials |
|