- 1-(2-Nitrophenyl)piperazine
-
- $0.37 / 1g
-
2024-10-22
- CAS:59084-06-9
- Min. Order: 1g
- Purity: 99%min cherry@coreychem.com
- Supply Ability: 1kg/10kg
- 1-(2-Nitrophenyl)piperazine
-
- $15.00 / 1KG
-
2021-08-12
- CAS:59084-06-9
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1-(2-Nitrophenyl)piperazine Basic information |
| Product Name: | 1-(2-Nitrophenyl)piperazine | | Synonyms: | 1-(2-NITROPHENYL)PIPERAZINE;1-(2-Nitrophenyl)piperazine 98%;1-(2-Nitrophenyl)piperazine ,98%;1-(2-Nitrophenyl)piperazine ,92%;Nitrophenylpiperazine;1-(2-Nitrophenyl)piperazine, 97.5%;Piperazine, 1-(2-nitrophenyl)-;1-Nitro-2-(1-piperazinyl)benzene | | CAS: | 59084-06-9 | | MF: | C10H13N3O2 | | MW: | 207.23 | | EINECS: | 261-593-1 | | Product Categories: | API intermediates | | Mol File: | 59084-06-9.mol |  |
| | 1-(2-Nitrophenyl)piperazine Chemical Properties |
| Boiling point | 142-144°C 1mm | | density | 1.222±0.06 g/cm3(Predicted) | | refractive index | 1.6080 to 1.6120 | | storage temp. | 2-8°C, protect from light | | form | clear liquid | | pka | 8.73±0.10(Predicted) | | color | Orange to Red | | InChI | 1S/C10H13N3O2/c14-13(15)10-4-2-1-3-9(10)12-7-5-11-6-8-12/h1-4,11H,5-8H2 | | InChIKey | YJRCDSXLKPERNV-UHFFFAOYSA-N | | SMILES | [N+](=O)([O-])c1c(cccc1)N2CCNCC2 | | CAS DataBase Reference | 59084-06-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36 | | Safety Statements | 26-36/37/39 | | Hazard Note | Irritant | | HazardClass | IRRITANT-HARMFUL | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 1-(2-Nitrophenyl)piperazine Usage And Synthesis |
| Chemical Properties | Yellow solid |
| | 1-(2-Nitrophenyl)piperazine Preparation Products And Raw materials |
|