3-(1,1,2,2-TETRAFLUOROETHOXY)BENZOIC ACID manufacturers
|
| | 3-(1,1,2,2-TETRAFLUOROETHOXY)BENZOIC ACID Basic information |
| Product Name: | 3-(1,1,2,2-TETRAFLUOROETHOXY)BENZOIC ACID | | Synonyms: | 3-Carboxy-alpha,alpha,beta,beta-tetrafluorophenetole;benzoic acid, 3-(1,1,2,2-tetrafluoroethoxy)-;(1,1,2,3-Tetrafluoroethoxy) Benzoate;AKOS MSC-0762;AKOS B000186;3-(1,1,2,2-TETRAFLUOROETHOXY)BENZOIC ACID;ART-CHEM-BB B000186;BUTTPARK 29\01-70 | | CAS: | 70126-48-6 | | MF: | C9H6F4O3 | | MW: | 238.14 | | EINECS: | | | Product Categories: | C9;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 70126-48-6.mol |  |
| | 3-(1,1,2,2-TETRAFLUOROETHOXY)BENZOIC ACID Chemical Properties |
| Melting point | 122-126 °C (lit.) | | Boiling point | 127-128 | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | 1S/C9H6F4O3/c10-8(11)9(12,13)16-6-3-1-2-5(4-6)7(14)15/h1-4,8H,(H,14,15) | | InChIKey | KXSUHQSIHGQDQV-UHFFFAOYSA-N | | SMILES | OC(=O)c1cccc(OC(F)(F)C(F)F)c1 | | CAS DataBase Reference | 70126-48-6(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3261 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | IRRITANT | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 3-(1,1,2,2-TETRAFLUOROETHOXY)BENZOIC ACID Usage And Synthesis |
| | 3-(1,1,2,2-TETRAFLUOROETHOXY)BENZOIC ACID Preparation Products And Raw materials |
|