|
|
| | Bis(trimethoxysilylpropyl)amine Basic information |
| | Bis(trimethoxysilylpropyl)amine Chemical Properties |
| Melting point | <0°C | | Boiling point | 152 °C4 mm Hg(lit.) | | density | 1.04 g/mL at 25 °C(lit.) | | vapor pressure | 0-12790Pa at 20-25℃ | | refractive index | n20/D 1.432(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C(protect from light) | | pka | 10.78±0.19(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.04 | | Water Solubility | 34-1000g/L at 20℃ | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 9569446 | | InChI | 1S/C12H31NO6Si2/c1-14-20(15-2,16-3)11-7-9-13-10-8-12-21(17-4,18-5)19-6/h13H,7-12H2,1-6H3 | | InChIKey | TZZGHGKTHXIOMN-UHFFFAOYSA-N | | SMILES | CO[Si](CCCNCCC[Si](OC)(OC)OC)(OC)OC | | LogP | -4-0.2 at 20℃ | | CAS DataBase Reference | 82985-35-1(CAS DataBase Reference) | | EPA Substance Registry System | 1-Propanamine, 3-(trimethoxysilyl)-N-[3-(trimethoxysilyl)propyl]- (82985-35-1) |
| Hazard Codes | Xn | | Risk Statements | 20/22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | RTECS | TX2101000 | | F | 3-10 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Dam. 1 |
| | Bis(trimethoxysilylpropyl)amine Usage And Synthesis |
| Uses | BTMSPA and 1,2-bis(triethoxysilyl)ethane (BTESE) can be used to synthesize an amine modified mesostructured organosilica for potential applications in catalysis and absorbance. Metal finishing may be deviced by coating BTMSPA and vinyltriacetoxysilane which can be used for protection against corrosion. | | Uses | Bis(trimethoxysilylpropyl)amine is used in method for dyeing keratinous material, comprising the use of an organosilicon compound, an effect pigment and a film-forming polymer. | | General Description | Bis[3-(trimethoxysilyl)propyl]amine (BTMSPA) is a bis-amino silane which can be used as a water based coupling agent that promotes the adhesion between different materials to form a hybrid material. The amino groups in the polymer provide coating strength to the modified metal surfaces. The silanol groups bond with the hydroxyls present on the surface of metals which are further cured to give metal-siloxane linkages. | | Hazard | A poison by ingestion and skin contact. A
moderate skin and severe eye irritant. | | Flammability and Explosibility | Not classified |
| | Bis(trimethoxysilylpropyl)amine Preparation Products And Raw materials |
|