- Farnesylacetone
-
- $30.00 / 5mg
-
2026-01-12
- CAS:1117-52-8
- Min. Order:
- Purity: 99.11%
- Supply Ability: 10g
|
| | (5E,9E)-6,10,14-Trimethylpentadeca-5,9,13-trien-2-one Basic information |
| Product Name: | (5E,9E)-6,10,14-Trimethylpentadeca-5,9,13-trien-2-one | | Synonyms: | (5E,9E)-6,10,14-Trimethylpentadeca-5,9,13-trien-2-one;FARNEZYLACETONE;FEMA 3442;(5E,9E)-6,10,14-Trimethyl-5,9,13-pentadecatrien-2-one;5,9,13-Pentadecatrien-2-one, 6,10,14-trimethyl-, (5E,9E)-;Einecs 214-246-3;(5E,9E)-6,10,14-Trim;(E,E)-FARNESYL ACETONE | | CAS: | 1117-52-8 | | MF: | C18H30O | | MW: | 262.43 | | EINECS: | 214-246-3 | | Product Categories: | Cnbio | | Mol File: | 1117-52-8.mol |  |
| | (5E,9E)-6,10,14-Trimethylpentadeca-5,9,13-trien-2-one Chemical Properties |
| Boiling point | 147-148 °C(Press: 0.5 Torr) | | density | 0.88 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.481 | | FEMA | 4213 | 3,7,11-TRIMETHYLDODECA-2,6,10-TRIENYL ACETATE | | storage temp. | 2-8°C | | solubility | DMSO (Sparingly), Ethyl Acetate (Slightly), Methanol (Sparingly) | | form | Oil | | color | Colourless | | Odor | flower ether | | Stability: | Light Sensitive | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C18H30O/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19/h9,11,13H,6-8,10,12,14H2,1-5H3/b16-11+,17-13+ | | InChIKey | LTUMRKDLVGQMJU-IUBLYSDUSA-N | | SMILES | CC(=O)CC/C=C(\C)/CC/C=C(\C)/CC/C=C(/C)\C | | LogP | 6.16 | | CAS DataBase Reference | 1117-52-8(CAS DataBase Reference) | | NIST Chemistry Reference | 5,9,13-Pentadecatrien-2-one, 6,10,14-trimethyl-, (e,e)-(1117-52-8) | | EPA Substance Registry System | 5,9,13-Pentadecatrien-2-one, 6,10,14-trimethyl-, (5E,9E)- (1117-52-8) |
| Safety Statements | 24/25 | | WGK Germany | 2 | | TSCA | TSCA listed | | HS Code | 29141900 |
| | (5E,9E)-6,10,14-Trimethylpentadeca-5,9,13-trien-2-one Usage And Synthesis |
| Uses | E,E-Farnesylacetone, is a natural organic compound which is present in many essential oils. It has been shown that, Farnesylacetone inhibits electron transport in isolated rat liver mitochondria. | | Definition | ChEBI: A terpene ketone in which an (E,E)-farnesyl group is bonded to one of the alpha-methyls of acetone. |
| | (5E,9E)-6,10,14-Trimethylpentadeca-5,9,13-trien-2-one Preparation Products And Raw materials |
| Raw materials | 3-Hepten-2-one, 3-(chloromethyl)-, (3Z)--->4,8-Tridecadienal, 4,8-dimethyl-12-oxo-, (4E,8E)--->ISOPROPYLTRIPHENYLPHOSPHONIUM IODIDE-->(E)-6,10-dimethylundeca-5,9-dien-2-yl acetate-->GERANYL CHLORIDE-->ACETOACETIC ACID N-PROPYL ESTER-->(4E,8E)-ethyl 2-acetyl-5,9,13-trimethyltetradeca-4,8,12-trienoate-->(E)-BETA-FARNESENE-->Isopropyl acetoacetate-->Methyl acetoacetate-->(6E,10E)-7,11,15-TRIMETHYL-3-OXOHEXADECA-6,10,14-TRIENOIC ACID, ETHYL ESTER, (MIXTURE OF ISOMERS)-->Geranylacetone | | Preparation Products | Teprenone Impurity 20 |
|