|
|
| | GOLD (III) ACETATE Basic information |
| Product Name: | GOLD (III) ACETATE | | Synonyms: | GOLD (III) ACETATE;Gold(Iii) Acetate (Metals Basis);Gold(III) acetate, 99.9% (metals basis);Gold(III) acetate, 99.9% trace metals basis;Acetic acid, gold(3+)salt (3:1);ld(III) acetate;GOLD (III) ACETATE ISO 9001：2015 REACH;Gold acetate solution | | CAS: | 15804-32-7 | | MF: | C2H4AuO2 | | MW: | 257.02 | | EINECS: | | | Product Categories: | | | Mol File: | 15804-32-7.mol |  |
| | GOLD (III) ACETATE Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | Brown | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C2H4O2.Au/c1-2(3)4;/h1H3,(H,3,4); | | InChIKey | CHUYYOSIZBKMJD-UHFFFAOYSA-N | | SMILES | C(=O)(O)C.[Au] | | CAS DataBase Reference | 15804-32-7 |
| Provider | Language |
|
ALFA
| English |
| | GOLD (III) ACETATE Usage And Synthesis |
| Uses | Used in solar energy technologies. Used in petrochemical cracking and automotive catalysts, water treatment, plating, textiles, research and in optic, laser, crystal and glass applications. |
| | GOLD (III) ACETATE Preparation Products And Raw materials |
|