|
|
| | cis-Hexahydrophthalic acid Basic information | | Uses |
| Product Name: | cis-Hexahydrophthalic acid | | Synonyms: | CIS-1,2-CYCLOHEXANEDICARBOXYLIC;(1R)-Cyclohexane-1β,2β-dicarboxylic acid;(1R,2S)-1,2-Cyclohexanedicarboxylic acid;Lurasidone Impurity 51;cis-1,2-Cyclohexanedicarboxylic acid,98%;cis-1,2-Cyclohexanedicarboxylic acid, 98% 25GR;(1R,2S)-cyclohexane-1,2-dicarboxylic acid;1,2-Cyclohexanedicarboxylicacid, (1R,2S)-rel- | | CAS: | 610-09-3 | | MF: | C8H12O4 | | MW: | 172.18 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 610-09-3.mol |  |
| | cis-Hexahydrophthalic acid Chemical Properties |
| Melting point | 188-192 °C | | Boiling point | 262.49°C (rough estimate) | | density | 1.2104 (rough estimate) | | refractive index | 1.4455 (estimate) | | Fp | 250°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Benzene,Ethanol,Methanol,Ether | | pka | pK1:4.34 ;pK2:6.76 (20°C) | | form | powder to crystal | | color | White | | Water Solubility | >2g/L(20 ºC) | | BRN | 2049754 | | InChI | InChI=1/C8H12O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6+ | | InChIKey | QSAWQNUELGIYBC-OLQVQODUNA-N | | SMILES | [C@@H]1(C(O)=O)CCCC[C@@H]1C(O)=O |&1:0,8,r| | | CAS DataBase Reference | 610-09-3 | | NIST Chemistry Reference | 1,2-Cyclohexanedicarboxylic acid, cis-(610-09-3) |
| | cis-Hexahydrophthalic acid Usage And Synthesis |
| Uses | Hexahydrophthalic acid is a carboxylic acid derivative that can be used to manufacture dyes, polyester resins, polyester fibers, pharmaceuticals, and plasticizers. | | Chemical Properties | white crystals | | Purification Methods | It is purified by recrystallisation from EtOH or H2O. [Smith & Byrne J Am Chem Soc 72 4406 1950, Abell J Org Chem 22 769 1957, Beilstein 9 III 3812, 9 IV 2801.] |
| | cis-Hexahydrophthalic acid Preparation Products And Raw materials |
|