- DL-NORADRENALINE
-
-
2025-12-24
- CAS:138-65-8
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
- DL-NORADRENALINE
-
- $1.00
-
2019-10-30
- CAS:138-65-8
- Min. Order: 25ASSAYS
- Purity: 99%
- Supply Ability: 1ton
- DL-NORADRENALINE
-
- $1.00
-
2019-07-31
- CAS:138-65-8
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100 Kilogram/Kilograms per Month in stock
|
| | DL-NORADRENALINE Basic information |
| Product Name: | DL-NORADRENALINE | | Synonyms: | 2-(3,4-Dihydroxyphenyl)-2-hydroxyethanamine;(R)-4-(2-aMino-1-hydroxyethyl)benzene-1,2-diol;1,2-Benzenediol, 4-(2-amino-1-hydroxyethyl)- (9CI);2-Amino-1-(3,4-dihydroxyphenyl)ethanol;4-(1-Hydroxy-2-aminoethyl)catechol;a-(Aminomethyl)-3,4-dihydroxybenzyl alcohol;Benzyl alcohol, a-(aminomethyl)-3,4-dihydroxy-, (+-)- (8CI);NSC 294898 | | CAS: | 138-65-8 | | MF: | C8H11NO3 | | MW: | 169.18 | | EINECS: | 205-337-9 | | Product Categories: | | | Mol File: | 138-65-8.mol |  |
| | DL-NORADRENALINE Chemical Properties |
| Melting point | ~190 °C (dec.) | | Boiling point | 298.46°C (rough estimate) | | density | 1.2435 (rough estimate) | | refractive index | 1.5100 (estimate) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Heated, Sonicated) | | pKa | 9.57±0.10(Predicted) | | form | Solid | | color | Pale Beige to Dark Brown | | Merck | 6695 | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2 | | InChIKey | SFLSHLFXELFNJZ-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C(O)CN)C=C1O | | CAS DataBase Reference | 138-65-8 |
| | DL-NORADRENALINE Usage And Synthesis |
| Uses | (±)-Noradrenaline is the neurotransmitter at most sympathetic neuroeffector junctions and has pharmacologic effects on both α1 and β1 adrenoceptors. | | Definition | ChEBI: A catecholamine in which C-1 of the aminoethyl side-chain is hydroxy-substituted. | | Safety Profile | Poison by intravenous route.When heated to decomposition it emits toxic fumes ofNOx. |
| | DL-NORADRENALINE Preparation Products And Raw materials |
|