|
|
| | TRIS(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATO)YTTERBIUM Basic information |
| Product Name: | TRIS(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATO)YTTERBIUM | | Synonyms: | YB(FOD);YB(FOD)3;YTTERBIUM FOD;YTTERBIUM(FOD)3;YTTERBIUM 6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATE;TRIS(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATE)YTTERBIUM(III);TRIS(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATO)YTTERBIUM;TRIS(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATO)YTTERBIUM(III) | | CAS: | 18323-96-1 | | MF: | C30H30F21O6Yb | | MW: | 1058.56 | | EINECS: | 242-211-2 | | Product Categories: | Other Metal;metal fluorobeta-diketonate complexes | | Mol File: | 18323-96-1.mol |  |
| | TRIS(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATO)YTTERBIUM Chemical Properties |
| Melting point | 108-111 °C(lit.) | | form | Powder | | color | off-white | | Water Solubility | Slowly degrades in water and soluble in hydrocarbons, alcohols, ketones, esters. | | Sensitive | Hygroscopic | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Stability: | hygroscopic | | InChI | 1S/3C10H11F7O2.Yb/c3*1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17;/h3*4,18H,1-3H3;/q;;;+3/p-3/b3*5-4-; | | InChIKey | KZBQCXBCJMHJOB-VNGPFPIXSA-K | | SMILES | CC(C)(C)C(\O[Yb](O\C(=C/C(=O)C(F)(F)C(F)(F)C(F)(F)F)C(C)(C)C)O\C(=C/C(=O)C(F)(F)C(F)(F)C(F)(F)F)C(C)(C)C)=C\C(=O)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 18323-96-1 | | EPA Substance Registry System | Ytterbium, tris(6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionato-.beta.O3,.beta.O5)- (18323-96-1) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | No | | HS Code | 28469000 | | Storage Class | 11 - Combustible Solids |
| | TRIS(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATO)YTTERBIUM Usage And Synthesis |
| Chemical Properties | off-white to yellow crystalline powder | | Uses | It is a reactant involved in the synthesis of rare earth metal complexes for separation of lanthanide metals, conformational mobility of substituted 2-methoxychalcones under the action of lanthanide shift reagents, NMR titration on cation-π complexes of bowl-shaped polycyclic aromatic hydrocarbons, specific recognition of chiral amino alcohols. It finds its application as catalysis and synthesis, optics & glasses, healthcare & biochemical. | | reaction suitability | core: erbium reagent type: catalyst |
| | TRIS(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATO)YTTERBIUM Preparation Products And Raw materials |
|