- Beaucage reagent
-
- $30.00 / 500mg
-
2026-01-04
- CAS:66304-01-6
- Min. Order:
- Purity: 98.50%
- Supply Ability: 10g
- Beaucage reagent
-
- $30.00 / 500mg
-
2026-01-04
- CAS:66304-01-6
- Min. Order:
- Purity: 98.50%
- Supply Ability: 10g
|
| | 3H-1,2-Benzodithiol-3-one-1,1-dioxide Basic information |
| Product Name: | 3H-1,2-Benzodithiol-3-one-1,1-dioxide | | Synonyms: | 3H-1,2-Benzodithiol-3-one-1,1-dioxide 97%;3H-1,2-BENZODITHIOL-3-ONE 1,1-DIOXIDE;3H-1,2-BENZODITHIOL-ONE 1,1-DIOXIDE;3H-1,2-BENZODITHIO-3-ONE-1,1-DIOXIDE;BEAUCAGE REAGENT;3H-1,2-BENZODITHIOL-3-ONE 1,1-DIOXIDE, 9 9%;BSS;3H-1,2-BENZODITHIOLE-3-ONE-1,1-DIOXIDE(BSS) | | CAS: | 66304-01-6 | | MF: | C7H4O3S2 | | MW: | 200.23 | | EINECS: | 000-000-0 | | Product Categories: | API intermediates;Phosphorylating and Phosphorothioating Agents;Biochemistry;Nucleosides, Nucleotides & Related Reagents;Protecting Agents, Phosphorylating Agents & Condensing Agents;Sulfur Compounds (for Synthesis);Synthetic Organic Chemistry;Regant series;OLED materials,pharm chemical,electronic;Nucleic acids | | Mol File: | 66304-01-6.mol |  |
| | 3H-1,2-Benzodithiol-3-one-1,1-dioxide Chemical Properties |
| Melting point | 103-107 °C(lit.) | | Boiling point | 414.6±28.0 °C(Predicted) | | density | 1.653±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Almost white | | BRN | 4180332 | | InChI | InChI=1S/C7H4O3S2/c8-7-5-3-1-2-4-6(5)12(9,10)11-7/h1-4H | | InChIKey | JUDOLRSMWHVKGX-UHFFFAOYSA-N | | SMILES | S1(=O)(=O)C2=CC=CC=C2C(=O)S1 | | CAS DataBase Reference | 66304-01-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | RIDADR | 3335 | | WGK Germany | 3 | | HazardClass | 9 | | HS Code | 29309090 |
| | 3H-1,2-Benzodithiol-3-one-1,1-dioxide Usage And Synthesis |
| Chemical Properties | White powder |
| | 3H-1,2-Benzodithiol-3-one-1,1-dioxide Preparation Products And Raw materials |
|