|
|
| | 4-Chloro-3-fluoronitrobenzene Basic information |
| Product Name: | 4-Chloro-3-fluoronitrobenzene | | Synonyms: | 4-Chloro-3-fluoronitrobenzenen;3-FLUORO-4-CHLORONITROBENZENE;4-CHLORO-3-FLUORONITROBENZENE;3-FLUORO-4-CHLORONITROBENZENE,99%;1-Chloro-2-fluoro-4-nitrobenzene >;2-Fluoro-4-nitrochlorobenzene;uoro-4-nitrobenzene;Benzene, 1-chloro-2-fluoro-4-nitro- | | CAS: | 350-31-2 | | MF: | C6H3ClFNO2 | | MW: | 175.54 | | EINECS: | 206-500-7 | | Product Categories: | Aromatic Halides (substituted) | | Mol File: | 350-31-2.mol |  |
| | 4-Chloro-3-fluoronitrobenzene Chemical Properties |
| Melting point | 61 °C | | Boiling point | 116 °C / 24mmHg | | density | 1.494±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C6H3ClFNO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H | | InChIKey | CSSSAKOGRYYMSA-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C([N+]([O-])=O)C=C1F | | CAS DataBase Reference | 350-31-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2904990090 |
| | 4-Chloro-3-fluoronitrobenzene Usage And Synthesis |
| Uses | 4-Chloro-3-fluoronitrobenzene is a nitrobenzene compound containing fluorine and chlorine atoms, which can be used as an intermediate in organic synthesis or as a reagent in chemical reactions. It can be used in fluorination reactions. |
| | 4-Chloro-3-fluoronitrobenzene Preparation Products And Raw materials |
|