3-METHYL-2-NITROBENZYL ALCOHOL manufacturers
|
| | 3-METHYL-2-NITROBENZYL ALCOHOL Basic information |
| | 3-METHYL-2-NITROBENZYL ALCOHOL Chemical Properties |
| Melting point | 48-50 °C(lit.) | | Boiling point | 295.73°C (rough estimate) | | density | 1.2917 (rough estimate) | | refractive index | 1.5570 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 14.04±0.10(Predicted) | | form | powder | | color | Faint yellow | | InChI | 1S/C8H9NO3/c1-6-3-2-4-7(5-10)8(6)9(11)12/h2-4,10H,5H2,1H3 | | InChIKey | NELPTBUSFQMYOB-UHFFFAOYSA-N | | SMILES | Cc1cccc(CO)c1[N+]([O-])=O | | CAS DataBase Reference | 80866-76-8 |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29062990 | | Storage Class | 11 - Combustible Solids |
| | 3-METHYL-2-NITROBENZYL ALCOHOL Usage And Synthesis |
| Chemical Properties | yellow-brown to brownish crystalline solid | | Uses | 3-Methyl-2-nitrobenzyl alcohol was used as starting reagent in the synthesis of 7-formyl-indole. | | General Description | 3-Methyl-2-nitrobenzyl alcohol undergoes condensation with N,N-dimethylformamide dimethyl acetal followed by catalytic hydrogenation to yield 7-hydroxymethyl-indole. |
| | 3-METHYL-2-NITROBENZYL ALCOHOL Preparation Products And Raw materials |
|