4-Chloro-5-nitrophthalimide manufacturers
- 4-chloro-5-nitrophthalimide
-
- $0.00 / 25kgs/paper drum
-
2026-02-03
- CAS:6015-57-2
- Min. Order: 25kgs/paper drum
- Purity: 98%
- Supply Ability: 10 tons
- 4-Chloro-5-nitrophthalimide
-
- $15.00 / 1KG
-
2021-08-12
- CAS:6015-57-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-Chloro-5-nitrophthalimide Basic information |
| Product Name: | 4-Chloro-5-nitrophthalimide | | Synonyms: | 4-CHLORO-5-NITROPHTHALIMIDE;5-CHLORO-6-NITROISOINDOLINE-1,3-DIONE;4-CHLORO-5-NITROPHTHALIMIDE 98%;BUTTPARK 94\57-86;5-Chloro-6-nitrosoisoindoline-1,3-dione;5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione;5-Chloro-6-nitroisoindolin-1,3-dione, 5-Chloro-6-nitro-1H-isoindole-1,3(2H)-dione;5-chloro-6-nitroso-2,3-dihydro-1H-isoindole-1,3-dione | | CAS: | 6015-57-2 | | MF: | C8H3ClN2O4 | | MW: | 226.57 | | EINECS: | | | Product Categories: | | | Mol File: | 6015-57-2.mol |  |
| | 4-Chloro-5-nitrophthalimide Chemical Properties |
| Melting point | 201 °C | | density | 1.725 | | refractive index | 1.6666 | | form | powder | | pka | 6.91±0.20(Predicted) | | color | Yellow | | BRN | 1536189 | | InChI | InChI=1S/C8H3ClN2O4/c9-5-1-3-4(2-6(5)11(14)15)8(13)10-7(3)12/h1-2H,(H,10,12,13) | | InChIKey | ADLVDYMTBOSDFE-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(Cl)C([N+]([O-])=O)=C2)C(=O)N1 | | CAS DataBase Reference | 6015-57-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | Hazard Note | Irritant | | HS Code | 2933998090 |
| Provider | Language |
|
ALFA
| English |
| | 4-Chloro-5-nitrophthalimide Usage And Synthesis |
| Chemical Properties | slight yellow to white crystalline powder | | Uses | 4-Chloro-5-nitropthalimide is a reagent used in the synthesis of novel benzimidazoles as antibacterial agents. Also used to prepare saludiuretic and anti-hypertensive agents. |
| | 4-Chloro-5-nitrophthalimide Preparation Products And Raw materials |
|