|
|
| | 1-Ethyl-3-phenyl-1H-pyrazole-5-carboxylic acid Basic information |
| | 1-Ethyl-3-phenyl-1H-pyrazole-5-carboxylic acid Chemical Properties |
| Boiling point | 423.8±33.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | pka | 3.14±0.10(Predicted) | | form | solid | | InChI | 1S/C12H12N2O2/c1-2-14-11(12(15)16)8-10(13-14)9-6-4-3-5-7-9/h3-8H,2H2,1H3,(H,15,16) | | InChIKey | AYFOSEQQADVGLW-UHFFFAOYSA-N | | SMILES | CCn1nc(cc1C(O)=O)-c2ccccc2 |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 1-Ethyl-3-phenyl-1H-pyrazole-5-carboxylic acid Usage And Synthesis |
| | 1-Ethyl-3-phenyl-1H-pyrazole-5-carboxylic acid Preparation Products And Raw materials |
|