| Company Name: |
ChengDu SinoStandards Bio-Tech Co.,Ltd. ， Gold
|
| Tel: |
028-83243028 19136088901 |
| Email: |
sinostandards@163.com |
| Products Intro: |
Product Name:Chloramphenicol-D5 (threo-Chloramphenicol-D5)
CAS:202480-68-0
Purity:标准品 Package:10mg;100mg;1g
|
CHLORAMPHENICOL (D5) manufacturers
- Chloramphenicol-d5
-
- $0.00 / 1mg
-
2026-01-04
- CAS:202480-68-0
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | CHLORAMPHENICOL (D5) Basic information |
| Product Name: | CHLORAMPHENICOL (D5) | | Synonyms: | CHLORAMPHENICOL (D5);D-threo-2,2-Dichloro-N-[β-hydroxy-α-(hydroxymethyl)-β-(4-nitrophenyl-2,3,5,6-d4)ethyl-β-d]acetamide;DL-threo-Chloramphenicol-d5,D-threo-2,2-Dichloro-N-[β-hydroxy-α-(hydroxymethyl)-β-(4-nitrophenyl-2,3,5,6-d4)ethyl-β-d]acetamide;Chloramphenicol D5 (ring D4, benzyl D);ChloraMphenicol D5 (ring D4, benzyl D) Solution, 100ug/Ml in Acetone;[2H5]-threo-Chloramphenicol;D5-threo-Chloramphenicol;D/L-thero-Chloramphenicol-D5 | | CAS: | 202480-68-0 | | MF: | C11H7Cl2D5N2O5 | | MW: | 328.16 | | EINECS: | | | Product Categories: | | | Mol File: | 202480-68-0.mol |  |
| | CHLORAMPHENICOL (D5) Chemical Properties |
| Melting point | 143 - 146°C | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C11H12Cl2N2O5/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20/h1-4,8-10,16-17H,5H2,(H,14,18)/t8-,9-/s3/i5D2,8D,9D,10D | | InChIKey | WIIZWVCIJKGZOK-QCHDQJKINA-N | | SMILES | [C@]([2H])(C([2H])([2H])O)(NC(=O)C([2H])(Cl)Cl)[C@]([2H])(O)C1C=CC([N+]([O-])=O)=CC=1 |&1:0,13,r| |
| Hazard Codes | T | | Risk Statements | 45 | | Safety Statements | 53-45 | | RTECS | AB6825000 |
| | CHLORAMPHENICOL (D5) Usage And Synthesis |
| Uses | Chloramphenicol D5 (CAS# 202480-68-0) can be used to calibrate to quantify chloramphenicol in chicken muscle using UHPLC/MS. |
| | CHLORAMPHENICOL (D5) Preparation Products And Raw materials |
|