| Company Name: |
Cochemical Ltd. |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
|
| | 2,6-Difluoro-3-iodobenzonitrile Basic information | | Uses |
| | 2,6-Difluoro-3-iodobenzonitrile Chemical Properties |
| storage temp. | 2-8°C, protect from light | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H2F2IN/c8-5-1-2-6(10)7(9)4(5)3-11/h1-2H | | InChIKey | SRRKQKUNLYGYPU-UHFFFAOYSA-N | | SMILES | C(#N)C1=C(F)C=CC(I)=C1F |
| | 2,6-Difluoro-3-iodobenzonitrile Usage And Synthesis |
| Uses | 2,6-Difluoro-3-iodobenzonitrile is a benzonitrile derivative and an important raw material and intermediate in organic synthesis. |
| | 2,6-Difluoro-3-iodobenzonitrile Preparation Products And Raw materials |
|