|
|
| | 4-Nitro-2-(trifluoromethyl)benzoyl chloride Basic information |
| | 4-Nitro-2-(trifluoromethyl)benzoyl chloride Chemical Properties |
| Melting point | 138-142 °C(lit.) | | Boiling point | 283.2±40.0 °C(Predicted) | | density | 1.573±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C8H3ClF3NO3/c9-7(14)5-2-1-4(13(15)16)3-6(5)8(10,11)12/h1-3H | | InChIKey | QLENXPZKYQCBKY-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C1=CC=C([N+]([O-])=O)C=C1C(F)(F)F |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36-43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant |
| | 4-Nitro-2-(trifluoromethyl)benzoyl chloride Usage And Synthesis |
| Description | 4-Nitro-2-(trifluoromethyl)benzoic acid is white to pale yellow crystalline powder, density: 1.596g/cm3, boiling point: 321.4oC at 760mmHg, melting point: 138-142oC(lit.). | | Uses | 4-Nitro-2-(trifluoromethyl)benzoic acid is mainly used as an important pharmaceutical and pesticide intermediate. | | Preparation | 4-Nitro-2-(trifluoromethyl)benzoic acid can be obtained by reacting 2-trifluoromethylbenzocyanide and nitrating agent as raw materials. |
| | 4-Nitro-2-(trifluoromethyl)benzoyl chloride Preparation Products And Raw materials |
|