- 2-Butoxyacetic acid
-
- $15.00 / 1KG
-
2021-08-12
- CAS:2516-93-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 2-Butoxyacetic acid
-
- $6.60 / 1KG
-
2019-12-26
- CAS:2516-93-0
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | 2-Butoxyacetic acid Basic information |
| | 2-Butoxyacetic acid Chemical Properties |
| Melting point | 108°C | | Boiling point | 108 °C | | density | 1.01 | | refractive index | 1.425-1.427 | | Fp | 234°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 3.55±0.10(Predicted) | | form | Liquid | | color | Clear colorless to light yellow | | InChI | InChI=1S/C6H12O3/c1-2-3-4-9-5-6(7)8/h2-5H2,1H3,(H,7,8) | | InChIKey | AJQOASGWDCBKCJ-UHFFFAOYSA-N | | SMILES | C(O)(=O)COCCCC | | CAS DataBase Reference | 2516-93-0(CAS DataBase Reference) | | EPA Substance Registry System | Acetic acid, butoxy- (2516-93-0) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 36/37/39-45-26 | | RIDADR | 3265 | | WGK Germany | WGK 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29189900 | | Storage Class | 8B - Non-combustible corrosive hazardous materials | | Hazard Classifications | Met. Corr. 1 Skin Corr. 1B |
| | 2-Butoxyacetic acid Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Definition | ChEBI: Butoxyacetic acid is a carboxylic acid. |
| | 2-Butoxyacetic acid Preparation Products And Raw materials |
|