|
|
| | 3,4-Difluorophenylboronic acid Basic information |
| Product Name: | 3,4-Difluorophenylboronic acid | | Synonyms: | 3,4-DIFLUOROBENZENE BORONIC ACID;3,4-DIFLUOROPHENYLBORONICACID;;3,4-Difluorophenylbo;3,4-Difluorophenylboronic acid, May contain varying amounts of anhydride, 97%;3,4-Difluorophenylboronic acid ,98%;3,4-Difluorophenylboronic acid,97%;dihydroxy(3,4-difluorophenyl)borane;3,4-DIFLUOROPHENYLBORONIC ACID FOR SYNTH;Boronic acid, B-(3,4-difluorophenyl)- | | CAS: | 168267-41-2 | | MF: | C6H5BF2O2 | | MW: | 157.91 | | EINECS: | 736-978-8 | | Product Categories: | Boronic Acids;Boronic Acids;Boronic Acids and Derivatives;Substituted Boronic Acids;Boronic Acid;Aryl;Halogenated;Organoborons;HALIDE;blocks;BoronicAcids;FluoroCompounds;Fluorin-contained phenyl boronic acid series;Liquid crystal intermediates | | Mol File: | 168267-41-2.mol |  |
| | 3,4-Difluorophenylboronic acid Chemical Properties |
| Melting point | 305-310 °C (lit.) | | Boiling point | 265.4±50.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Powder | | pka | 7.59±0.10(Predicted) | | color | White | | BRN | 7369788 | | InChI | InChI=1S/C6H5BF2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H | | InChIKey | RMGYQBHKEWWTOY-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(F)C(F)=C1)(O)O | | CAS DataBase Reference | 168267-41-2(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | 3,4-Difluorophenylboronic acid Usage And Synthesis |
| Chemical Properties | white powder | | Uses | suzuki reaction | | Uses | 3,4-Difluorophenylboronic Acid is used as a building block in the synthesis of several organic compounds including that of substituted 6-phenylpurine bases and nucleosides via Suzuki-Miyaura cross-coupling reactions which show significant cytostatic activity in CCRF-CEM, HeLa, and L1210 cell lines. It is also used in the preparation of a potent cell penetrant Legumain inhibitor, 10t. | | Uses | Intermediates of Liquid Crystals |
| | 3,4-Difluorophenylboronic acid Preparation Products And Raw materials |
|