| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | 2-((2,6-dimethoxyphenyl)amino)-2-oxoacetic acid(WXC06271) Basic information |
| | 2-((2,6-dimethoxyphenyl)amino)-2-oxoacetic acid(WXC06271) Chemical Properties |
| density | 1.363±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | powder | | pka | 0.07±0.54(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H11NO5/c1-15-6-4-3-5-7(16-2)8(6)11-9(12)10(13)14/h3-5H,1-2H3,(H,11,12)(H,13,14) | | InChIKey | AULRRTNGXKPSPX-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(NC1=C(OC)C=CC=C1OC)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-((2,6-dimethoxyphenyl)amino)-2-oxoacetic acid(WXC06271) Usage And Synthesis |
| Uses | 2,6-Dimethoxyanilino(oxo)acetic acid is also referred to as [(2,6-dimethylphenyl)carbamoyl]formic acid. | | General Description | 2,6-Dimethoxyanilino(oxo)acetic acid is also referred to as [(2,6-dimethylphenyl)carbamoyl]formic acid. | | reaction suitability | reagent type: ligand |
| | 2-((2,6-dimethoxyphenyl)amino)-2-oxoacetic acid(WXC06271) Preparation Products And Raw materials |
|