| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | 2-(4-Formyl-phenoxy)-propionic acid Basic information |
| Product Name: | 2-(4-Formyl-phenoxy)-propionic acid | | Synonyms: | VITAS-BB TBB000343;CHEMBRDG-BB 6251408;2-(4-FORMYLPHENOXY)PROPANOIC ACID;OTAVA-BB 1120399;2-(4-formylphenoxy)propanoic acid(SALTDATA: FREE);Propanoic acid, 2-(4-formylphenoxy)-;2-(4-Formyl-phenoxy)-propionic acid | | CAS: | 51264-78-9 | | MF: | C10H10O4 | | MW: | 194.18 | | EINECS: | | | Product Categories: | | | Mol File: | 51264-78-9.mol |  |
| | 2-(4-Formyl-phenoxy)-propionic acid Chemical Properties |
| Melting point | 125 °C(Solv: water (7732-18-5)) | | Boiling point | 371.0±17.0 °C(Predicted) | | density | 1.268±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 3.08±0.10(Predicted) | | form | solid | | InChI | 1S/C10H10O4/c1-7(10(12)13)14-9-4-2-8(6-11)3-5-9/h2-7H,1H3,(H,12,13) | | InChIKey | OIQBPASRUVCUAN-UHFFFAOYSA-N | | SMILES | O=C(O)C(C)OC(C=C1)=CC=C1C([H])=O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(4-Formyl-phenoxy)-propionic acid Usage And Synthesis |
| | 2-(4-Formyl-phenoxy)-propionic acid Preparation Products And Raw materials |
|