- 4-(METHYLTHIO)THIOPHENOL
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1122-97-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-(METHYLTHIO)THIOPHENOL Basic information |
| | 4-(METHYLTHIO)THIOPHENOL Chemical Properties |
| Melting point | 19-23 °C | | Boiling point | 116-117°C 3mm | | density | 1.19 | | refractive index | 1.6530 | | Fp | >230 °F | | pka | 6.37±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | Sensitive | Air Sensitive | | BRN | 1931500 | | InChI | InChI=1S/C7H8S2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 | | InChIKey | KYMOWQQIZINTJZ-UHFFFAOYSA-N | | SMILES | C1(S)=CC=C(SC)C=C1 | | CAS DataBase Reference | 1122-97-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26-36/37 | | RIDADR | 2810 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2930909899 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 |
| | 4-(METHYLTHIO)THIOPHENOL Usage And Synthesis |
| | 4-(METHYLTHIO)THIOPHENOL Preparation Products And Raw materials |
|