| Company Name: |
Shanghai T&W Pharmaceutical Co., Ltd.
|
| Tel: |
+86 21 61551611 |
| Email: |
|
| Products Intro: |
Product Name:P-NITROPHENYL VALERATE
CAS:1956-07-6
Purity:98% Package:50kg;25kg;10kg;5kg;500g;500mg;
|
| Company Name: |
Shanghai Run-Biotech Co., Ltd.
|
| Tel: |
021-57171705 13817537615 |
| Email: |
sales@run-biotech.com |
| Products Intro: |
Product Name:4-Nitrophenyl pentanoate
CAS:1956-07-6
Purity:97% Package:5g 10g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:4-Nitrophenyl valerate
CAS:1956-07-6
Purity:liquid Package:10G Remarks:N4377-10G
|
|
| | P-NITROPHENYL VALERATE Basic information |
| Product Name: | P-NITROPHENYL VALERATE | | Synonyms: | PENTANOIC ACID 4-NITROPHENYL ESTER;P-NITROPHENYL VALERATE;4-nitrophenyl valerate;4-Nitrophenol valerate;4-Nitrophenyl pentanoate;Pentanoic acid p-nitrophenyl ester;Valeric acid 4-nitrophenyl ester;4-Nitrophenyl valerate liquid | | CAS: | 1956-07-6 | | MF: | C11H13NO4 | | MW: | 223.23 | | EINECS: | | | Product Categories: | | | Mol File: | 1956-07-6.mol |  |
| | P-NITROPHENYL VALERATE Chemical Properties |
| Boiling point | 158-160 °C(Press: 0.6 Torr) | | density | 1.184±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | liquid | | color | yellow | | InChI | InChI=1S/C11H13NO4/c1-2-3-4-11(13)16-10-7-5-9(6-8-10)12(14)15/h5-8H,2-4H2,1H3 | | InChIKey | RJQXEHRFVKJLJO-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C([N+]([O-])=O)C=C1)(=O)CCCC |
| | P-NITROPHENYL VALERATE Usage And Synthesis |
| Uses | 4-Nitrophenyl valerate has been used as a substrate solution to measure the rate of p-nitrophenol formation using p-nitrophenyl valerate as substrate. It has also been used as a substrate to measure general esterase activity in hepatopancreas extracts. | | Biological Activity | 4-Nitrophenyl valerate acts as a model substrate for carboxylesterase and butyrylcholinesterase. |
| | P-NITROPHENYL VALERATE Preparation Products And Raw materials |
|