- Fmoc-L-Glu-OtBu
-
- $0.00/ kg
-
2026-04-29
- CAS:84793-07-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Fmoc-L-Glutamic acid 1-tert-butyl ester Basic information |
| Product Name: | Fmoc-L-Glutamic acid 1-tert-butyl ester | | Synonyms: | L-GLUTAMIC ACID, N-[(9H-FLUOREN-9-YLMETHOXY)CARBONYL]-, 1-(1,1-DIMETHYLETHYL) ESTER;N-α-Fmoc-L-glutamic acid α-tert butyl ester;Fmoc glutamic acid butyl ester;N-FMoc-L-glutaMic acid 1-tert-butyl ester;Fmoc-L-glutamic acid α-tert-butyl ester≥ 98% (HPLC, Chiral purity);N-FMOC-L-GLUTAMIC ACID-1-T-BUTYL ESTER;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-L-GLUTAMIC ACID ALPHA-T-BUTYL ESTER;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-L-GLUTAMIC-ACID-T-BUTYL ESTER | | CAS: | 84793-07-7 | | MF: | C24H27NO6 | | MW: | 425.47 | | EINECS: | | | Product Categories: | Glutamic acid [Glu, E] | | Mol File: | 84793-07-7.mol |  |
| | Fmoc-L-Glutamic acid 1-tert-butyl ester Chemical Properties |
| Melting point | 78-80 °C | | Boiling point | 638.1±55.0 °C(Predicted) | | density | 1.232±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 4.46±0.10(Predicted) | | color | White to off-white | | Major Application | peptide synthesis | | InChIKey | GOPWHXPXSPIIQZ-FQEVSTJZSA-N | | SMILES | C(OC(C)(C)C)(=O)[C@H](CCC(O)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 84793-07-7(CAS DataBase Reference) |
| WGK Germany | WGK 2 | | HS Code | 29224290 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-L-Glutamic acid 1-tert-butyl ester Usage And Synthesis |
| Chemical Properties | White powder crystal | | Uses |
Fmoc-L-Glutamic acid 1-tert-butyl ester is most often used in peptide synthesis.
| | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis | | Synthesis | (S)-4-Amino-5-tert-butoxy-5-oxovaleric acid (1.50 g, 7.38 mmol) was dissolved in 1,4-dioxane (40 mL) and cooled to 0 °C. An aqueous solution of sodium carbonate (196 mg, 1.85 mmol) (20 mL) and Fmoc-Cl (2.11 g, 8.16 mmol) were added sequentially. The reaction mixture was slowly warmed to room temperature and stirred for 16 hours. Upon completion of the reaction, the pH was adjusted to slightly acidic (pH ≈ 6) with 2 M hydrochloric acid, and the pH was adjusted with 1 M citric acid (ca. 80 mL) to ca. 3. The reaction mixture was extracted with ethyl acetate (3 x 100 mL). The organic phases were combined, dried over anhydrous sodium sulfate, filtered and the filtrate concentrated under reduced pressure. The crude product was purified by silica gel column chromatography with the eluent being a 3:2 solvent mixture of ethyl acetate/hexane to afford (S)-4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-5-(tert-butoxy)-5-oxopentanoic acid (3.10 g, 99%) as a white solid.1H NMR (300 MHz, CDCl3) δ: Carboxylic acid peak (1H) not observed (due to broad signal), 7.76 (d, J = 7.5 Hz, 2H), 7.61-7.58 (m, 2H), 7.42-7.26 (m, 4H), 5.45 (d, J = 7.8 Hz, 1H), 4.48-4.19 (m, 4H), 2.51-2.34 (m, 2H), 2.28-2.14 (m, 1H), 1.99 -1.88 (m, 1H), 1.47 (s, 9H); ESI MS m/z = 448 [M + Na]+. | | References | [1] Patent: US2014/274951, 2014, A1. Location in patent: Paragraph 0373; 0374 |
| | Fmoc-L-Glutamic acid 1-tert-butyl ester Preparation Products And Raw materials |
|